C11H18Cl5N3 — CID 69382257
3-butyl-4-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole (PubChem CID 69382257) has the molecular formula C11H18Cl5N3 and a molecular weight of 369.55 g/mol. Its IUPAC name is 3-butyl-4-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole.
| Compound Name | 3-butyl-4-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69382257 |
| Molecular Formula | C11H18Cl5N3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-butyl-4-(1,1,2,2,2-pentachloroethyl)-2-propyl-3H-1,2,4-triazole |
| SMILES | CCCCC1N(CCC)N=CN1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl5N3/c1-3-5-6-9-18(8-17-19(9)7-4-2)11(15,16)10(12,13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | OXRWIPPDTRMRSS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|