C9H16N4 — CID 87804786
2-ethyl-3-(2-methylpropyl)-3H-1,2,4-triazole-4-carbonitrile (PubChem CID 87804786) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-ethyl-3-(2-methylpropyl)-3H-1,2,4-triazole-4-carbonitrile.
| Compound Name | 2-ethyl-3-(2-methylpropyl)-3H-1,2,4-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 87804786 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-ethyl-3-(2-methylpropyl)-3H-1,2,4-triazole-4-carbonitrile |
| SMILES | CCN1N=CN(C#N)C1CC(C)C |
| InChI | InChI=1S/C9H16N4/c1-4-13-9(5-8(2)3)12(6-10)7-11-13/h7-9H,4-5H2,1-3H3 |
| InChIKey | ORZCSYNIPRYRIK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|