C5H5N5 — CID 87803793
2-methyl-3H-1,2,4-triazole-3,4-dicarbonitrile (PubChem CID 87803793) has the molecular formula C5H5N5 and a molecular weight of 135.13 g/mol. Its IUPAC name is 2-methyl-3H-1,2,4-triazole-3,4-dicarbonitrile.
| Compound Name | 2-methyl-3H-1,2,4-triazole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 87803793 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 2-methyl-3H-1,2,4-triazole-3,4-dicarbonitrile |
| SMILES | CN1N=CN(C#N)C1C#N |
| InChI | InChI=1S/C5H5N5/c1-9-5(2-6)10(3-7)4-8-9/h4-5H,1H3 |
| InChIKey | WCNHNKIMPMBSPJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 66.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|