C7H9N5 — CID 87805016
2-propan-2-yl-3H-1,2,4-triazole-3,4-dicarbonitrile (PubChem CID 87805016) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-propan-2-yl-3H-1,2,4-triazole-3,4-dicarbonitrile.
| Compound Name | 2-propan-2-yl-3H-1,2,4-triazole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 87805016 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-propan-2-yl-3H-1,2,4-triazole-3,4-dicarbonitrile |
| SMILES | CC(C)N1N=CN(C#N)C1C#N |
| InChI | InChI=1S/C7H9N5/c1-6(2)12-7(3-8)11(4-9)5-10-12/h5-7H,1-2H3 |
| InChIKey | ANNORRAATRXFJB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|