C7H12N4 — CID 69388856
2,4-diethyl-3H-1,2,4-triazole-3-carbonitrile (PubChem CID 69388856) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 2,4-diethyl-3H-1,2,4-triazole-3-carbonitrile.
| Compound Name | 2,4-diethyl-3H-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 69388856 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 2,4-diethyl-3H-1,2,4-triazole-3-carbonitrile |
| SMILES | CCN1C=NN(CC)C1C#N |
| InChI | InChI=1S/C7H12N4/c1-3-10-6-9-11(4-2)7(10)5-8/h6-7H,3-4H2,1-2H3 |
| InChIKey | KAMYZUUTFMGAOC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |