C8H16ClN3 — CID 69383310
3-chloro-2,4-dipropyl-3H-1,2,4-triazole (PubChem CID 69383310) has the molecular formula C8H16ClN3 and a molecular weight of 189.69 g/mol. Its IUPAC name is 3-chloro-2,4-dipropyl-3H-1,2,4-triazole.
| Compound Name | 3-chloro-2,4-dipropyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69383310 |
| Molecular Formula | C8H16ClN3 |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-chloro-2,4-dipropyl-3H-1,2,4-triazole |
| SMILES | CCCN1C=NN(CCC)C1Cl |
| InChI | InChI=1S/C8H16ClN3/c1-3-5-11-7-10-12(6-4-2)8(11)9/h7-8H,3-6H2,1-2H3 |
| InChIKey | PAALZLHAMMZZLY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|