C6H12ClN3 — CID 69386693
3-chloro-4-methyl-2-propyl-3H-1,2,4-triazole (PubChem CID 69386693) has the molecular formula C6H12ClN3 and a molecular weight of 161.64 g/mol. Its IUPAC name is 3-chloro-4-methyl-2-propyl-3H-1,2,4-triazole.
| Compound Name | 3-chloro-4-methyl-2-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69386693 |
| Molecular Formula | C6H12ClN3 |
| Molecular Weight | 161.64 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 3-chloro-4-methyl-2-propyl-3H-1,2,4-triazole |
| SMILES | CCCN1N=CN(C)C1Cl |
| InChI | InChI=1S/C6H12ClN3/c1-3-4-10-6(7)9(2)5-8-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | DEDYHAPMPHMCOW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|