C7H7F5N4 — CID 87804644
2-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-4-carbonitrile (PubChem CID 87804644) has the molecular formula C7H7F5N4 and a molecular weight of 242.15 g/mol. Its IUPAC name is 2-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-4-carbonitrile.
| Compound Name | 2-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 87804644 |
| Molecular Formula | C7H7F5N4 |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-4-carbonitrile |
| SMILES | CCN1N=CN(C#N)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F5N4/c1-2-16-5(15(3-13)4-14-16)6(8,9)7(10,11)12/h4-5H,2H2,1H3 |
| InChIKey | CJOJYBDOZZBZCT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|