C5H7N5O2 — CID 69388041
2-ethyl-4-nitro-3H-1,2,4-triazole-3-carbonitrile (PubChem CID 69388041) has the molecular formula C5H7N5O2 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-ethyl-4-nitro-3H-1,2,4-triazole-3-carbonitrile.
| Compound Name | 2-ethyl-4-nitro-3H-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 69388041 |
| Molecular Formula | C5H7N5O2 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-ethyl-4-nitro-3H-1,2,4-triazole-3-carbonitrile |
| SMILES | CCN1N=CN([N+](=O)[O-])C1C#N |
| InChI | InChI=1S/C5H7N5O2/c1-2-8-5(3-6)9(4-7-8)10(11)12/h4-5H,2H2,1H3 |
| InChIKey | VBVRFBYZTRTBOC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 85.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|