C6H5F5N4 — CID 87804687
2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-3-carbonitrile (PubChem CID 87804687) has the molecular formula C6H5F5N4 and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-3-carbonitrile.
| Compound Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 87804687 |
| Molecular Formula | C6H5F5N4 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole-3-carbonitrile |
| SMILES | CN1N=CN(C(F)(F)C(F)(F)F)C1C#N |
| InChI | InChI=1S/C6H5F5N4/c1-14-4(2-12)15(3-13-14)6(10,11)5(7,8)9/h3-4H,1H3 |
| InChIKey | RQYRARMPLMPHAA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|