C9H14F5N3 — CID 87803491
2-methyl-3-(2-methylpropyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole (PubChem CID 87803491) has the molecular formula C9H14F5N3 and a molecular weight of 259.22 g/mol. Its IUPAC name is 2-methyl-3-(2-methylpropyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole.
| Compound Name | 2-methyl-3-(2-methylpropyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87803491 |
| Molecular Formula | C9H14F5N3 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-methyl-3-(2-methylpropyl)-4-(1,1,2,2,2-pentafluoroethyl)-3H-1,2,4-triazole |
| SMILES | CC(C)CC1N(C)N=CN1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14F5N3/c1-6(2)4-7-16(3)15-5-17(7)9(13,14)8(10,11)12/h5-7H,4H2,1-3H3 |
| InChIKey | RFQHSOOGMZRORB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|