C19H34N2O4 — CID 56992266
methyl (2S)-3-[(1-amino-2,3,3-trimethyl-1-oxobutan-2-yl)carbamoyl]-5-methyl-2-prop-2-enylhexanoate (PubChem CID 56992266) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl (2S)-3-[(1-amino-2,3,3-trimethyl-1-oxobutan-2-yl)carbamoyl]-5-methyl-2-prop-2-enylhexanoate.
| Compound Name | methyl (2S)-3-[(1-amino-2,3,3-trimethyl-1-oxobutan-2-yl)carbamoyl]-5-methyl-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 56992266 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | methyl (2S)-3-[(1-amino-2,3,3-trimethyl-1-oxobutan-2-yl)carbamoyl]-5-methyl-2-prop-2-enylhexanoate |
| SMILES | C=CC[C@H](C(=O)OC)C(CC(C)C)C(=O)NC(C)(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C19H34N2O4/c1-9-10-13(16(23)25-8)14(11-12(2)3)15(22)21-19(7,17(20)24)18(4,5)6/h9,12-14H,1,10-11H2,2-8H3,(H2,20,24)(H,21,22)/t13-,14?,19?/m0/s1 |
| InChIKey | PBWBDKAMAUQZAA-CDJWAVJASA-N |
| XLogP | 2.42 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|