C24H42N2O4 — CID 19083200
tert-butyl 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoate (PubChem CID 19083200) has the molecular formula C24H42N2O4 and a molecular weight of 422.61 g/mol. Its IUPAC name is tert-butyl 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoate.
| Compound Name | tert-butyl 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 19083200 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | tert-butyl 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)C(CC(C)C)C(=O)NC(C(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C24H42N2O4/c1-10-11-17(22(29)30-24(7,8)9)18(14-15(2)3)20(27)26-19(23(4,5)6)21(28)25-16-12-13-16/h10,15-19H,1,11-14H2,2-9H3,(H,25,28)(H,26,27) |
| InChIKey | HSKTZTRNPWRAGB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|