C20H34N2O4 — CID 54415848
3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid (PubChem CID 54415848) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid.
| Compound Name | 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 54415848 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
| SMILES | C=CCC(C(=O)O)C(CC(C)C)C(=O)NC(C(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C20H34N2O4/c1-7-8-14(19(25)26)15(11-12(2)3)17(23)22-16(20(4,5)6)18(24)21-13-9-10-13/h7,12-16H,1,8-11H2,2-6H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | VXIRQQJXKWIAQH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|