C23H42N2O3 — CID 18723781
(E)-9,9-dimethyl-2-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-3-[(E)-prop-1-enyl]undec-6-enoic acid (PubChem CID 18723781) has the molecular formula C23H42N2O3 and a molecular weight of 394.60 g/mol. Its IUPAC name is (E)-9,9-dimethyl-2-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-3-[(E)-prop-1-enyl]undec-6-enoic acid.
| Compound Name | (E)-9,9-dimethyl-2-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-3-[(E)-prop-1-enyl]undec-6-enoic acid |
|---|---|
| PubChem CID | 18723781 |
| Molecular Formula | C23H42N2O3 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | (E)-9,9-dimethyl-2-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-3-[(E)-prop-1-enyl]undec-6-enoic acid |
| SMILES | C/C=C/C(CC/C=C/CC(C)(C)CC)C(CC(=O)NCCNCCC)C(=O)O |
| InChI | InChI=1S/C23H42N2O3/c1-6-12-19(13-10-9-11-14-23(4,5)8-3)20(22(27)28)18-21(26)25-17-16-24-15-7-2/h6,9,11-12,19-20,24H,7-8,10,13-18H2,1-5H3,(H,25,26)(H,27,28)/b11-9+,12-6+ |
| InChIKey | BUSPMCQXIGJKHT-WIPAEPSYSA-N |
| XLogP | 4.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|