C42H80N4O3 — CID 86022804
11-[2-[9-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-9-oxononyl]-5,6-dipentylcyclohex-2-en-1-yl]undec-9-enoic acid (PubChem CID 86022804) has the molecular formula C42H80N4O3 and a molecular weight of 689.13 g/mol. Its IUPAC name is 11-[2-[9-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-9-oxononyl]-5,6-dipentylcyclohex-2-en-1-yl]undec-9-enoic acid.
| Compound Name | 11-[2-[9-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-9-oxononyl]-5,6-dipentylcyclohex-2-en-1-yl]undec-9-enoic acid |
|---|---|
| PubChem CID | 86022804 |
| Molecular Formula | C42H80N4O3 |
| Molecular Weight | 689.13 g/mol |
| Exact Mass | 688.62 |
| IUPAC Name | 11-[2-[9-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-9-oxononyl]-5,6-dipentylcyclohex-2-en-1-yl]undec-9-enoic acid |
| SMILES | CCCCCC1CC=C(CCCCCCCCC(=O)NCCNCCNCCN)C(CC=CCCCCCCCC(=O)O)C1CCCCC |
| InChI | InChI=1S/C42H80N4O3/c1-3-5-17-23-37-29-30-38(24-19-13-11-12-15-21-27-41(47)46-36-35-45-34-33-44-32-31-43)40(39(37)25-18-6-4-2)26-20-14-9-7-8-10-16-22-28-42(48)49/h14,20,30,37,39-40,44-45H,3-13,15-19,21-29,31-36,43H2,1-2H3,(H,46,47)(H,48,49) |
| InChIKey | HOIFCNTYWGLPRI-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.13 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|