C28H54N4O3 — CID 22964420
5-hexyl-3-[8-[2-[2-[2-(methylamino)ethylamino]ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22964420) has the molecular formula C28H54N4O3 and a molecular weight of 494.77 g/mol. Its IUPAC name is 5-hexyl-3-[8-[2-[2-[2-(methylamino)ethylamino]ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 5-hexyl-3-[8-[2-[2-[2-(methylamino)ethylamino]ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22964420 |
| Molecular Formula | C28H54N4O3 |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.42 |
| IUPAC Name | 5-hexyl-3-[8-[2-[2-[2-(methylamino)ethylamino]ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCCCC1C=C(CCCCCCCC(=O)NCCNCCNCCNC)CC(C(=O)O)C1 |
| InChI | InChI=1S/C28H54N4O3/c1-3-4-5-9-12-24-21-25(23-26(22-24)28(34)35)13-10-7-6-8-11-14-27(33)32-20-19-31-18-17-30-16-15-29-2/h21,24,26,29-31H,3-20,22-23H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | GQNYTIMAIPMOMJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|