C26H49N3O3 — CID 22964422
5-hexyl-3-[8-[2-[2-(methylamino)ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22964422) has the molecular formula C26H49N3O3 and a molecular weight of 451.70 g/mol. Its IUPAC name is 5-hexyl-3-[8-[2-[2-(methylamino)ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 5-hexyl-3-[8-[2-[2-(methylamino)ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22964422 |
| Molecular Formula | C26H49N3O3 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | 5-hexyl-3-[8-[2-[2-(methylamino)ethylamino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCCCC1C=C(CCCCCCCC(=O)NCCNCCNC)CC(C(=O)O)C1 |
| InChI | InChI=1S/C26H49N3O3/c1-3-4-5-9-12-22-19-23(21-24(20-22)26(31)32)13-10-7-6-8-11-14-25(30)29-18-17-28-16-15-27-2/h19,22,24,27-28H,3-18,20-21H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | QPETYYRRNKSWTR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|