C36H72N4O6Si — CID 22964421
5-hexyl-3-[8-[2-[2-(methylamino)ethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22964421) has the molecular formula C36H72N4O6Si and a molecular weight of 685.08 g/mol. Its IUPAC name is 5-hexyl-3-[8-[2-[2-(methylamino)ethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 5-hexyl-3-[8-[2-[2-(methylamino)ethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22964421 |
| Molecular Formula | C36H72N4O6Si |
| Molecular Weight | 685.08 g/mol |
| Exact Mass | 684.52 |
| IUPAC Name | 5-hexyl-3-[8-[2-[2-(methylamino)ethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethylamino]-8-oxooctyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCCCC1C=C(CCCCCCCC(=O)NCCN(CCNC)CNCCC[Si](OCC)(OCC)OCC)CC(C(=O)O)C1 |
| InChI | InChI=1S/C36H72N4O6Si/c1-6-10-11-15-19-32-28-33(30-34(29-32)36(42)43)20-16-13-12-14-17-21-35(41)39-24-26-40(25-23-37-5)31-38-22-18-27-47(44-7-2,45-8-3)46-9-4/h28,32,34,37-38H,6-27,29-31H2,1-5H3,(H,39,41)(H,42,43) |
| InChIKey | GMOGWFKPYPBKHJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.08 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|