C39H77N5O6Si — CID 22964425
8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-[2-[2-(methylamino)ethylamino]ethyl]-N-[2-(3-triethoxysilylpropylcarbamoylamino)ethyl]octanamide (PubChem CID 22964425) has the molecular formula C39H77N5O6Si and a molecular weight of 740.16 g/mol. Its IUPAC name is 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-[2-[2-(methylamino)ethylamino]ethyl]-N-[2-(3-triethoxysilylpropylcarbamoylamino)ethyl]octanamide.
| Compound Name | 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-[2-[2-(methylamino)ethylamino]ethyl]-N-[2-(3-triethoxysilylpropylcarbamoylamino)ethyl]octanamide |
|---|---|
| PubChem CID | 22964425 |
| Molecular Formula | C39H77N5O6Si |
| Molecular Weight | 740.16 g/mol |
| Exact Mass | 739.56 |
| IUPAC Name | 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-[2-[2-(methylamino)ethylamino]ethyl]-N-[2-(3-triethoxysilylpropylcarbamoylamino)ethyl]octanamide |
| SMILES | CCCCCCC1C=C(CCCCCCCC(=O)N(CCNCCNC)CCNC(=O)NCCC[Si](OCC)(OCC)OCC)CC(C(C)=O)C1 |
| InChI | InChI=1S/C39H77N5O6Si/c1-7-11-12-16-20-35-31-36(33-37(32-35)34(5)45)21-17-14-13-15-18-22-38(46)44(28-26-41-25-24-40-6)29-27-43-39(47)42-23-19-30-51(48-8-2,49-9-3)50-10-4/h31,35,37,40-41H,7-30,32-33H2,1-6H3,(H2,42,43,47) |
| InChIKey | DNOKMHQSXGIRND-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.16 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|