C34H67N5O6Si — CID 22964432
8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-(methylamino)ethyl]-N-[2-[1-(3-triethoxysilylpropylcarbamoylamino)ethylamino]ethyl]octanamide (PubChem CID 22964432) has the molecular formula C34H67N5O6Si and a molecular weight of 670.03 g/mol. Its IUPAC name is 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-(methylamino)ethyl]-N-[2-[1-(3-triethoxysilylpropylcarbamoylamino)ethylamino]ethyl]octanamide.
| Compound Name | 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-(methylamino)ethyl]-N-[2-[1-(3-triethoxysilylpropylcarbamoylamino)ethylamino]ethyl]octanamide |
|---|---|
| PubChem CID | 22964432 |
| Molecular Formula | C34H67N5O6Si |
| Molecular Weight | 670.03 g/mol |
| Exact Mass | 669.49 |
| IUPAC Name | 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-(methylamino)ethyl]-N-[2-[1-(3-triethoxysilylpropylcarbamoylamino)ethylamino]ethyl]octanamide |
| SMILES | CCO[Si](CCCNC(=O)NC(C)NCCN(CCNC)C(=O)CCCCCCCC1=CC(C)CC(C(C)=O)C1)(OCC)OCC |
| InChI | InChI=1S/C34H67N5O6Si/c1-8-43-46(44-9-2,45-10-3)24-16-19-37-34(42)38-30(6)36-21-23-39(22-20-35-7)33(41)18-15-13-11-12-14-17-31-25-28(4)26-32(27-31)29(5)40/h25,28,30,32,35-36H,8-24,26-27H2,1-7H3,(H2,37,38,42) |
| InChIKey | XWYHXAONPAGYIU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|