C30H59N5O4Si — CID 123321393
8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-[1-aminoethyl(3-ethoxysilylpropylcarbamoyl)amino]ethyl]-N-[2-(methylamino)ethyl]octanamide (PubChem CID 123321393) has the molecular formula C30H59N5O4Si and a molecular weight of 581.92 g/mol. Its IUPAC name is 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-[1-aminoethyl(3-ethoxysilylpropylcarbamoyl)amino]ethyl]-N-[2-(methylamino)ethyl]octanamide.
| Compound Name | 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-[1-aminoethyl(3-ethoxysilylpropylcarbamoyl)amino]ethyl]-N-[2-(methylamino)ethyl]octanamide |
|---|---|
| PubChem CID | 123321393 |
| Molecular Formula | C30H59N5O4Si |
| Molecular Weight | 581.92 g/mol |
| Exact Mass | 581.43 |
| IUPAC Name | 8-(5-acetyl-3-methylcyclohexen-1-yl)-N-[2-[1-aminoethyl(3-ethoxysilylpropylcarbamoyl)amino]ethyl]-N-[2-(methylamino)ethyl]octanamide |
| SMILES | CCO[SiH2]CCCNC(=O)N(CCN(CCNC)C(=O)CCCCCCCC1=CC(C)CC(C(C)=O)C1)C(C)N |
| InChI | InChI=1S/C30H59N5O4Si/c1-6-39-40-20-12-15-33-30(38)35(26(4)31)19-18-34(17-16-32-5)29(37)14-11-9-7-8-10-13-27-21-24(2)22-28(23-27)25(3)36/h21,24,26,28,32H,6-20,22-23,31,40H2,1-5H3,(H,33,38) |
| InChIKey | YIYUVZOOQDCFJU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|