C37H72N4O6Si — CID 22964428
8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-(2-aminoethyl)-N-[3-(3-triethoxysilylpropylcarbamoylamino)propyl]octanamide (PubChem CID 22964428) has the molecular formula C37H72N4O6Si and a molecular weight of 697.09 g/mol. Its IUPAC name is 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-(2-aminoethyl)-N-[3-(3-triethoxysilylpropylcarbamoylamino)propyl]octanamide.
| Compound Name | 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-(2-aminoethyl)-N-[3-(3-triethoxysilylpropylcarbamoylamino)propyl]octanamide |
|---|---|
| PubChem CID | 22964428 |
| Molecular Formula | C37H72N4O6Si |
| Molecular Weight | 697.09 g/mol |
| Exact Mass | 696.52 |
| IUPAC Name | 8-(5-acetyl-3-hexylcyclohexen-1-yl)-N-(2-aminoethyl)-N-[3-(3-triethoxysilylpropylcarbamoylamino)propyl]octanamide |
| SMILES | CCCCCCC1C=C(CCCCCCCC(=O)N(CCN)CCCNC(=O)NCCC[Si](OCC)(OCC)OCC)CC(C(C)=O)C1 |
| InChI | InChI=1S/C37H72N4O6Si/c1-6-10-11-15-20-33-29-34(31-35(30-33)32(5)42)21-16-13-12-14-17-22-36(43)41(27-23-38)26-18-24-39-37(44)40-25-19-28-48(45-7-2,46-8-3)47-9-4/h29,33,35H,6-28,30-31,38H2,1-5H3,(H2,39,40,44) |
| InChIKey | GBCUKBSACXVPRD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.09 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|