C19H32N2O4 — CID 70245006
2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclopentadec-10-en-6-yl]acetic acid (PubChem CID 70245006) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclopentadec-10-en-6-yl]acetic acid.
| Compound Name | 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclopentadec-10-en-6-yl]acetic acid |
|---|---|
| PubChem CID | 70245006 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclopentadec-10-en-6-yl]acetic acid |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](CC(=O)O)CCC/C=C/CCCCN(C)C1=O |
| InChI | InChI=1S/C19H32N2O4/c1-14(2)17-19(25)21(3)12-10-8-6-4-5-7-9-11-15(13-16(22)23)18(24)20-17/h4-5,14-15,17H,6-13H2,1-3H3,(H,20,24)(H,22,23)/b5-4+/t15-,17+/m1/s1 |
| InChIKey | HXLMUSWNRRPGGC-LUJIMGINSA-N |
| XLogP | 2.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|