C19H34N2O4 — CID 74959940
13-[[2-(butylamino)-2-oxoacetyl]amino]tridec-8-enoic acid (PubChem CID 74959940) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is 13-[[2-(butylamino)-2-oxoacetyl]amino]tridec-8-enoic acid.
| Compound Name | 13-[[2-(butylamino)-2-oxoacetyl]amino]tridec-8-enoic acid |
|---|---|
| PubChem CID | 74959940 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 13-[[2-(butylamino)-2-oxoacetyl]amino]tridec-8-enoic acid |
| SMILES | CCCCNC(=O)C(=O)NCCCCC=CCCCCCCC(=O)O |
| InChI | InChI=1S/C19H34N2O4/c1-2-3-15-20-18(24)19(25)21-16-13-11-9-7-5-4-6-8-10-12-14-17(22)23/h5,7H,2-4,6,8-16H2,1H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | YJEAFIXGOUHZFP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|