C25H46N2O4 — CID 54404014
2-[2-(3-acetamidopropanoylamino)ethyl]octadec-9-enoic acid (PubChem CID 54404014) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-[2-(3-acetamidopropanoylamino)ethyl]octadec-9-enoic acid.
| Compound Name | 2-[2-(3-acetamidopropanoylamino)ethyl]octadec-9-enoic acid |
|---|---|
| PubChem CID | 54404014 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 2-[2-(3-acetamidopropanoylamino)ethyl]octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC(CCNC(=O)CCNC(C)=O)C(=O)O |
| InChI | InChI=1S/C25H46N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(25(30)31)18-20-27-24(29)19-21-26-22(2)28/h10-11,23H,3-9,12-21H2,1-2H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | VPJXPSNZZLJFEK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|