C41H80N2O3 — CID 6437987
(Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide;(Z)-octadec-9-enoic acid (PubChem CID 6437987) has the molecular formula C41H80N2O3 and a molecular weight of 649.10 g/mol. Its IUPAC name is (Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide;(Z)-octadec-9-enoic acid.
| Compound Name | (Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6437987 |
| Molecular Formula | C41H80N2O3 |
| Molecular Weight | 649.10 g/mol |
| Exact Mass | 648.62 |
| IUPAC Name | (Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCN(C)C.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C23H46N2O.C18H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h11-12H,4-10,13-22H2,1-3H3,(H,24,26);9-10H,2-8,11-17H2,1H3,(H,19,20)/b12-11-;10-9- |
| InChIKey | XLAFVLJQVVZACK-RNCLGPNQSA-N |
| XLogP | 12.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.10 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|