C20H34N2O4 — CID 70244693
2-[2,5-dioxo-1,3-di(propan-2-yl)-1,4-diazacyclotetradec-10-en-6-yl]acetic acid (PubChem CID 70244693) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[2,5-dioxo-1,3-di(propan-2-yl)-1,4-diazacyclotetradec-10-en-6-yl]acetic acid.
| Compound Name | 2-[2,5-dioxo-1,3-di(propan-2-yl)-1,4-diazacyclotetradec-10-en-6-yl]acetic acid |
|---|---|
| PubChem CID | 70244693 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-[2,5-dioxo-1,3-di(propan-2-yl)-1,4-diazacyclotetradec-10-en-6-yl]acetic acid |
| SMILES | CC(C)C1NC(=O)C(CC(=O)O)CCCC=CCCCN(C(C)C)C1=O |
| InChI | InChI=1S/C20H34N2O4/c1-14(2)18-20(26)22(15(3)4)12-10-8-6-5-7-9-11-16(13-17(23)24)19(25)21-18/h5-6,14-16,18H,7-13H2,1-4H3,(H,21,25)(H,23,24) |
| InChIKey | JSCDVSMECSJDDQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|