C23H44N2O3 — CID 91052733
ethyl 5,7-diethyl-3,5,7-trimethyl-4-[2-(methylamino)butanoylamino]non-8-enoate (PubChem CID 91052733) has the molecular formula C23H44N2O3 and a molecular weight of 396.62 g/mol. Its IUPAC name is ethyl 5,7-diethyl-3,5,7-trimethyl-4-[2-(methylamino)butanoylamino]non-8-enoate.
| Compound Name | ethyl 5,7-diethyl-3,5,7-trimethyl-4-[2-(methylamino)butanoylamino]non-8-enoate |
|---|---|
| PubChem CID | 91052733 |
| Molecular Formula | C23H44N2O3 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | ethyl 5,7-diethyl-3,5,7-trimethyl-4-[2-(methylamino)butanoylamino]non-8-enoate |
| SMILES | C=CC(C)(CC)CC(C)(CC)C(NC(=O)C(CC)NC)C(C)CC(=O)OCC |
| InChI | InChI=1S/C23H44N2O3/c1-10-18(24-9)21(27)25-20(17(6)15-19(26)28-14-5)23(8,13-4)16-22(7,11-2)12-3/h11,17-18,20,24H,2,10,12-16H2,1,3-9H3,(H,25,27) |
| InChIKey | JENROROMLLJEKL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|