C25H42N3O5+ — CID 144711412
[(2R)-2-[[(2S)-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carbonyl]amino]pent-4-enoyl]azanium (PubChem CID 144711412) has the molecular formula C25H42N3O5+ and a molecular weight of 464.63 g/mol. Its IUPAC name is [(2R)-2-[[(2S)-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carbonyl]amino]pent-4-enoyl]azanium.
| Compound Name | [(2R)-2-[[(2S)-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carbonyl]amino]pent-4-enoyl]azanium |
|---|---|
| PubChem CID | 144711412 |
| Molecular Formula | C25H42N3O5+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [(2R)-2-[[(2S)-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carbonyl]amino]pent-4-enoyl]azanium |
| SMILES | C=CCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@H](CC=C)C([NH3+])=O |
| InChI | InChI=1S/C25H41N3O5/c1-6-8-9-10-11-14-18(17-21(29)33-25(3,4)5)24(32)28-16-12-15-20(28)23(31)27-19(13-7-2)22(26)30/h6-7,18-20H,1-2,8-17H2,3-5H3,(H2,26,30)(H,27,31)/p+1/t18-,19-,20+/m1/s1 |
| InChIKey | GSEUIHXTWHOZTA-AQNXPRMDSA-O |
| XLogP | 2.29 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|