C29H46N2O7 — CID 59571125
ethyl (1S,4R,6S,15R,19R)-19-methoxy-2,16-dioxo-15-(2-oxo-2-pent-4-enoxyethyl)-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylate (PubChem CID 59571125) has the molecular formula C29H46N2O7 and a molecular weight of 534.69 g/mol. Its IUPAC name is ethyl (1S,4R,6S,15R,19R)-19-methoxy-2,16-dioxo-15-(2-oxo-2-pent-4-enoxyethyl)-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,15R,19R)-19-methoxy-2,16-dioxo-15-(2-oxo-2-pent-4-enoxyethyl)-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylate |
|---|---|
| PubChem CID | 59571125 |
| Molecular Formula | C29H46N2O7 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | ethyl (1S,4R,6S,15R,19R)-19-methoxy-2,16-dioxo-15-(2-oxo-2-pent-4-enoxyethyl)-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylate |
| SMILES | C=CCCCOC(=O)C[C@H]1CCCCCCCC[C@H]2C[C@@]2(C(=O)OCC)NC(=O)[C@@H]2C[C@@H](OC)CN2C1=O |
| InChI | InChI=1S/C29H46N2O7/c1-4-6-13-16-38-25(32)17-21-14-11-9-7-8-10-12-15-22-19-29(22,28(35)37-5-2)30-26(33)24-18-23(36-3)20-31(24)27(21)34/h4,21-24H,1,5-20H2,2-3H3,(H,30,33)/t21-,22+,23-,24+,29-/m1/s1 |
| InChIKey | HBJKNRYZZJTHBO-IPMVRARQSA-N |
| XLogP | 3.69 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|