C20H36N2O4 — CID 135779860
(2S,3S)-3-[[3,3-dimethyl-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid (PubChem CID 135779860) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is (2S,3S)-3-[[3,3-dimethyl-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid.
| Compound Name | (2S,3S)-3-[[3,3-dimethyl-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 135779860 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2S,3S)-3-[[3,3-dimethyl-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
| SMILES | C=CC[C@H](C(=O)O)[C@H](CC(C)C)C(=O)NC(C(=O)NC(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O4/c1-9-10-14(19(25)26)15(11-12(2)3)17(23)22-16(20(6,7)8)18(24)21-13(4)5/h9,12-16H,1,10-11H2,2-8H3,(H,21,24)(H,22,23)(H,25,26)/t14-,15-,16?/m0/s1 |
| InChIKey | RSEOMJXHNZBSCW-KSCSMHSMSA-N |
| XLogP | 2.98 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|