C22H34BrN3O3 — CID 56993772
2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]-N,N'-dipentylpropanediamide (PubChem CID 56993772) has the molecular formula C22H34BrN3O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]-N,N'-dipentylpropanediamide.
| Compound Name | 2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]-N,N'-dipentylpropanediamide |
|---|---|
| PubChem CID | 56993772 |
| Molecular Formula | C22H34BrN3O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[[(2R)-2-bromo-3-phenylpropanoyl]amino]-N,N'-dipentylpropanediamide |
| SMILES | CCCCCNC(=O)C(NC(=O)[C@H](Br)Cc1ccccc1)C(=O)NCCCCC |
| InChI | InChI=1S/C22H34BrN3O3/c1-3-5-10-14-24-21(28)19(22(29)25-15-11-6-4-2)26-20(27)18(23)16-17-12-8-7-9-13-17/h7-9,12-13,18-19H,3-6,10-11,14-16H2,1-2H3,(H,24,28)(H,25,29)(H,26,27)/t18-/m1/s1 |
| InChIKey | SUDGVSAMLUHENX-GOSISDBHSA-N |
| XLogP | 3.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|