C15H26O3 — CID 56995929
(4S,5R)-2,2-dimethyl-4-oct-1-enyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane (PubChem CID 56995929) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (4S,5R)-2,2-dimethyl-4-oct-1-enyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane.
| Compound Name | (4S,5R)-2,2-dimethyl-4-oct-1-enyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 56995929 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (4S,5R)-2,2-dimethyl-4-oct-1-enyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane |
| SMILES | CCCCCCC=C[C@@H]1OC(C)(C)O[C@H]1[C@H]1CO1 |
| InChI | InChI=1S/C15H26O3/c1-4-5-6-7-8-9-10-12-14(13-11-16-13)18-15(2,3)17-12/h9-10,12-14H,4-8,11H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | ZVVSFKITTDTOHL-BFHYXJOUSA-N |
| XLogP | 3.43 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|