C10H21N5 — CID 56996932
2,2-di(piperazin-1-yl)ethanimine (PubChem CID 56996932) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 2,2-di(piperazin-1-yl)ethanimine.
| Compound Name | 2,2-di(piperazin-1-yl)ethanimine |
|---|---|
| PubChem CID | 56996932 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 2,2-di(piperazin-1-yl)ethanimine |
| SMILES | [H]/N=C/C(N1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C10H21N5/c11-9-10(14-5-1-12-2-6-14)15-7-3-13-4-8-15/h9-13H,1-8H2/b11-9+ |
| InChIKey | IWBIILNHJLRDFR-PKNBQFBNSA-N |
| XLogP | -1.23 |
| TPSA | 54.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|