C23H31NO5 — CID 57000246
[2-[(8S,9R,10S,13S,14S)-9-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-nitrosoethyl] acetate (PubChem CID 57000246) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S)-9-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-nitrosoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S)-9-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-nitrosoethyl] acetate |
|---|---|
| PubChem CID | 57000246 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S)-9-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-nitrosoethyl] acetate |
| SMILES | CC(=O)OCC(N=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(O)CC[C@]12C |
| InChI | InChI=1S/C23H31NO5/c1-14(25)29-13-20(24-28)19-7-6-17-18-5-4-15-12-16(26)8-9-22(15,3)23(18,27)11-10-21(17,19)2/h7,12,17-18,20,27H,4-6,8-11,13H2,1-3H3/t17-,18-,20?,21-,22-,23+/m0/s1 |
| InChIKey | KAZDDMZBTYOOMH-PFQBVERTSA-N |
| XLogP | 3.87 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|