C8H6N2O4 — CID 57001223
1-(2,5-dihydroxypyrrol-1-yl)pyrrole-2,5-dione (PubChem CID 57001223) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57001223 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1n1c(O)ccc1O |
| InChI | InChI=1S/C8H6N2O4/c11-5-1-2-6(12)9(5)10-7(13)3-4-8(10)14/h1-4,11-12H |
| InChIKey | UTYPEUVZYRWYBR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|