C8H11N3O4 — CID 54082843
N'-(2,5-dihydroxypyrrol-1-yl)butanediamide (PubChem CID 54082843) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is N'-(2,5-dihydroxypyrrol-1-yl)butanediamide.
| Compound Name | N'-(2,5-dihydroxypyrrol-1-yl)butanediamide |
|---|---|
| PubChem CID | 54082843 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N'-(2,5-dihydroxypyrrol-1-yl)butanediamide |
| SMILES | NC(=O)CCC(=O)Nn1c(O)ccc1O |
| InChI | InChI=1S/C8H11N3O4/c9-5(12)1-2-6(13)10-11-7(14)3-4-8(11)15/h3-4,14-15H,1-2H2,(H2,9,12)(H,10,13) |
| InChIKey | MOIHGLXAFVIBTI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |