C10H17N3O3 — CID 54078590
6-(2,5-dihydroxypyrrol-1-yl)hexanehydrazide (PubChem CID 54078590) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 6-(2,5-dihydroxypyrrol-1-yl)hexanehydrazide.
| Compound Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanehydrazide |
|---|---|
| PubChem CID | 54078590 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanehydrazide |
| SMILES | NNC(=O)CCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C10H17N3O3/c11-12-8(14)4-2-1-3-7-13-9(15)5-6-10(13)16/h5-6,15-16H,1-4,7,11H2,(H,12,14) |
| InChIKey | MLLUMWGJTXOSFW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|