C12H17N3O4 — CID 91067701
1-[2-(2,5-dihydroxypyrrol-1-yl)ethylamino]azepane-2,5-dione (PubChem CID 91067701) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[2-(2,5-dihydroxypyrrol-1-yl)ethylamino]azepane-2,5-dione.
| Compound Name | 1-[2-(2,5-dihydroxypyrrol-1-yl)ethylamino]azepane-2,5-dione |
|---|---|
| PubChem CID | 91067701 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[2-(2,5-dihydroxypyrrol-1-yl)ethylamino]azepane-2,5-dione |
| SMILES | O=C1CCC(=O)N(NCCn2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C12H17N3O4/c16-9-1-2-12(19)15(7-5-9)13-6-8-14-10(17)3-4-11(14)18/h3-4,13,17-18H,1-2,5-8H2 |
| InChIKey | FOWDXZJKGIQZOC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |