C10H14N2O3 — CID 91392783
4-(2,5-dihydroxypyrrol-1-yl)azepan-2-one (PubChem CID 91392783) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)azepan-2-one.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 91392783 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)azepan-2-one |
| SMILES | O=C1CC(n2c(O)ccc2O)CCCN1 |
| InChI | InChI=1S/C10H14N2O3/c13-8-6-7(2-1-5-11-8)12-9(14)3-4-10(12)15/h3-4,7,14-15H,1-2,5-6H2,(H,11,13) |
| InChIKey | NAFLDIGRJUEYJP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |