C15H25N3O4 — CID 123669029
N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]hexanamide (PubChem CID 123669029) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]hexanamide.
| Compound Name | N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]hexanamide |
|---|---|
| PubChem CID | 123669029 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCNC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C15H25N3O4/c1-2-3-4-5-12(19)16-9-10-17-13(20)8-11-18-14(21)6-7-15(18)22/h6-7,21-22H,2-5,8-11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | JWEKLURIRMHHAG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|