C13H22N3O4P — CID 123457820
6-[3-(2,5-dihydroxy-3-phosphanylpyrrol-1-yl)propanoylamino]hexanamide (PubChem CID 123457820) has the molecular formula C13H22N3O4P and a molecular weight of 315.31 g/mol. Its IUPAC name is 6-[3-(2,5-dihydroxy-3-phosphanylpyrrol-1-yl)propanoylamino]hexanamide.
| Compound Name | 6-[3-(2,5-dihydroxy-3-phosphanylpyrrol-1-yl)propanoylamino]hexanamide |
|---|---|
| PubChem CID | 123457820 |
| Molecular Formula | C13H22N3O4P |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 6-[3-(2,5-dihydroxy-3-phosphanylpyrrol-1-yl)propanoylamino]hexanamide |
| SMILES | NC(=O)CCCCCNC(=O)CCn1c(O)cc(P)c1O |
| InChI | InChI=1S/C13H22N3O4P/c14-10(17)4-2-1-3-6-15-11(18)5-7-16-12(19)8-9(21)13(16)20/h8,19-20H,1-7,21H2,(H2,14,17)(H,15,18) |
| InChIKey | BYANZLJWPTWQPD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|