C10H14N2O3 — CID 90822006
3-(2,5-dihydroxypyrrol-1-yl)azepan-2-one (PubChem CID 90822006) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)azepan-2-one.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 90822006 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)azepan-2-one |
| SMILES | O=C1NCCCCC1n1c(O)ccc1O |
| InChI | InChI=1S/C10H14N2O3/c13-8-4-5-9(14)12(8)7-3-1-2-6-11-10(7)15/h4-5,7,13-14H,1-3,6H2,(H,11,15) |
| InChIKey | LNOZHMJKAXYRBB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |