C9H14N2O3 — CID 90861012
4-(2,5-dihydroxypyrrol-1-yl)-N-methylbutanamide (PubChem CID 90861012) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)-N-methylbutanamide.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 90861012 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1c(O)ccc1O |
| InChI | InChI=1S/C9H14N2O3/c1-10-7(12)3-2-6-11-8(13)4-5-9(11)14/h4-5,13-14H,2-3,6H2,1H3,(H,10,12) |
| InChIKey | BCSLTHZIWDQUOA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |