C16H30N2O2 — CID 54276979
1-(12-aminododecyl)pyrrole-2,5-diol (PubChem CID 54276979) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(12-aminododecyl)pyrrole-2,5-diol.
| Compound Name | 1-(12-aminododecyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54276979 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-(12-aminododecyl)pyrrole-2,5-diol |
| SMILES | NCCCCCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C16H30N2O2/c17-13-9-7-5-3-1-2-4-6-8-10-14-18-15(19)11-12-16(18)20/h11-12,19-20H,1-10,13-14,17H2 |
| InChIKey | ROBWOEJEHRYNDE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|