C8H10N2O3 — CID 54051975
1-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one (PubChem CID 54051975) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 54051975 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1n1c(O)ccc1O |
| InChI | InChI=1S/C8H10N2O3/c11-6-2-1-5-9(6)10-7(12)3-4-8(10)13/h3-4,12-13H,1-2,5H2 |
| InChIKey | LTNMUXLGWKAWDH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |