C10H12N2O5 — CID 54530056
(2,5-dihydroxypyrrol-1-yl) 2-(2-oxopyrrolidin-1-yl)acetate (PubChem CID 54530056) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-oxopyrrolidin-1-yl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-oxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 54530056 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-oxopyrrolidin-1-yl)acetate |
| SMILES | O=C(CN1CCCC1=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H12N2O5/c13-7-2-1-5-11(7)6-10(16)17-12-8(14)3-4-9(12)15/h3-4,14-15H,1-2,5-6H2 |
| InChIKey | YVWIWUBUMSZKEV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |