C9H9N3O6 — CID 90844437
bis(2,5-dihydroxypyrrol-1-yl)carbamic acid (PubChem CID 90844437) has the molecular formula C9H9N3O6 and a molecular weight of 255.19 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl)carbamic acid.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl)carbamic acid |
|---|---|
| PubChem CID | 90844437 |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl)carbamic acid |
| SMILES | O=C(O)N(n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H9N3O6/c13-5-1-2-6(14)10(5)12(9(17)18)11-7(15)3-4-8(11)16/h1-4,13-16H,(H,17,18) |
| InChIKey | FQFNDQBKALHICW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |