C25H26N4O3 — CID 57003425
N-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]-4-(1H-imidazol-2-yl)benzamide (PubChem CID 57003425) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]-4-(1H-imidazol-2-yl)benzamide.
| Compound Name | N-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]-4-(1H-imidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 57003425 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[2-[(2-hydroxy-3-naphthalen-1-yloxypropyl)amino]ethyl]-4-(1H-imidazol-2-yl)benzamide |
| SMILES | O=C(NCCNCC(O)COc1cccc2ccccc12)c1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c30-21(17-32-23-7-3-5-18-4-1-2-6-22(18)23)16-26-12-13-29-25(31)20-10-8-19(9-11-20)24-27-14-15-28-24/h1-11,14-15,21,26,30H,12-13,16-17H2,(H,27,28)(H,29,31) |
| InChIKey | QRWKRPOGRDGEEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|